C27H30N4O2S — CID 141178382
5-[1-(benzenesulfonyl)piperidin-4-yl]-3-methyl-5-(3-phenylphenyl)-4H-imidazol-2-amine (PubChem CID 141178382) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-methyl-5-(3-phenylphenyl)-4H-imidazol-2-amine.
| Compound Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-methyl-5-(3-phenylphenyl)-4H-imidazol-2-amine |
|---|---|
| PubChem CID | 141178382 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 5-[1-(benzenesulfonyl)piperidin-4-yl]-3-methyl-5-(3-phenylphenyl)-4H-imidazol-2-amine |
| SMILES | CN1CC(c2cccc(-c3ccccc3)c2)(C2CCN(S(=O)(=O)c3ccccc3)CC2)N=C1N |
| InChI | InChI=1S/C27H30N4O2S/c1-30-20-27(29-26(30)28,24-12-8-11-22(19-24)21-9-4-2-5-10-21)23-15-17-31(18-16-23)34(32,33)25-13-6-3-7-14-25/h2-14,19,23H,15-18,20H2,1H3,(H2,28,29) |
| InChIKey | SIJUJYZECBBLGW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |