C14H16N2O5 — CID 141178760
(3,5-dihydroxy-2-methyl-4-oxopentyl) indazole-1-carboxylate (PubChem CID 141178760) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is (3,5-dihydroxy-2-methyl-4-oxopentyl) indazole-1-carboxylate.
| Compound Name | (3,5-dihydroxy-2-methyl-4-oxopentyl) indazole-1-carboxylate |
|---|---|
| PubChem CID | 141178760 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (3,5-dihydroxy-2-methyl-4-oxopentyl) indazole-1-carboxylate |
| SMILES | CC(COC(=O)n1ncc2ccccc21)C(O)C(=O)CO |
| InChI | InChI=1S/C14H16N2O5/c1-9(13(19)12(18)7-17)8-21-14(20)16-11-5-3-2-4-10(11)6-15-16/h2-6,9,13,17,19H,7-8H2,1H3 |
| InChIKey | QAWZKLQHDHPZKS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |