About 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine
5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine (PubChem CID 14117946) has the molecular formula C8H3BrCl2N2S
and a molecular weight of 310.00 g/mol. Its IUPAC name is 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine.
Molecular Properties
| Compound Name | 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine |
| PubChem CID | 14117946 |
| Molecular Formula | C8H3BrCl2N2S |
| Molecular Weight | 310.00 g/mol |
| Exact Mass | 307.86 |
| IUPAC Name | 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine |
| SMILES | Clc1nc(Cl)c(Br)c(-c2cccs2)n1 |
| InChI | InChI=1S/C8H3BrCl2N2S/c9-5-6(4-2-1-3-14-4)12-8(11)13-7(5)10/h1-3H |
| InChIKey | DWKOYDPVVRZISR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.00 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine?
The IUPAC name of 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine (CID 14117946) is 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine.
What is the SMILES notation for 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine?
The canonical SMILES for 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine is Clc1nc(Cl)c(Br)c(-c2cccs2)n1.
What is the InChIKey of 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine?
The InChIKey is DWKOYDPVVRZISR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrCl2N2S/c9-5-6(4-2-1-3-14-4)12-8(11)13-7(5)10/h1-3H.
What are the key properties of 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine?
5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine has a molecular weight of 310.00 g/mol, XLogP of 4.27, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-dichloro-6-thiophen-2-ylpyrimidine is sourced from PubChem (CID 14117946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).