C10H21NO5 — CID 141184455
(2S,3S,4S,5R)-2-[butylamino(hydroxy)methyl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 141184455) has the molecular formula C10H21NO5 and a molecular weight of 235.28 g/mol. Its IUPAC name is (2S,3S,4S,5R)-2-[butylamino(hydroxy)methyl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2S,3S,4S,5R)-2-[butylamino(hydroxy)methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 141184455 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (2S,3S,4S,5R)-2-[butylamino(hydroxy)methyl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCNC(O)[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21NO5/c1-2-3-4-11-10(15)9-8(14)7(13)6(5-12)16-9/h6-15H,2-5H2,1H3/t6-,7-,8+,9+,10?/m1/s1 |
| InChIKey | MHWLCNIMMPGNFP-NTUKYRGVSA-N |
| XLogP | -1.82 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|