C16H22O5 — CID 141190409
ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylate (PubChem CID 141190409) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylate.
| Compound Name | ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylate |
|---|---|
| PubChem CID | 141190409 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC2(C(=O)OC(C)(C)C)OC12 |
| InChI | InChI=1S/C16H22O5/c1-14(2,3)20-12(17)10-8-7-9-16(11(10)19-16)13(18)21-15(4,5)6/h7-9,11H,1-6H3 |
| InChIKey | IAKLQKQYRBCTQG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|