C16H22O7 — CID 154021666
ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboperoxoate (PubChem CID 154021666) has the molecular formula C16H22O7 and a molecular weight of 326.35 g/mol. Its IUPAC name is ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboperoxoate.
| Compound Name | ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboperoxoate |
|---|---|
| PubChem CID | 154021666 |
| Molecular Formula | C16H22O7 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | ditert-butyl 7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)C1=CC=CC2(C(=O)OOC(C)(C)C)OC12 |
| InChI | InChI=1S/C16H22O7/c1-14(2,3)22-20-12(17)10-8-7-9-16(11(10)19-16)13(18)21-23-15(4,5)6/h7-9,11H,1-6H3 |
| InChIKey | UCGRYIMLHFEJHF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|