C17H18O8 — CID 175284754
cyclohexa-2,5-diene-1,4-dione;1,2-dimethoxy-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 175284754) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is cyclohexa-2,5-diene-1,4-dione;1,2-dimethoxy-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | cyclohexa-2,5-diene-1,4-dione;1,2-dimethoxy-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175284754 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | cyclohexa-2,5-diene-1,4-dione;1,2-dimethoxy-5-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | COC1C(C(=O)O)=CC(C)=CC1(OC)C(=O)O.O=C1C=CC(=O)C=C1 |
| InChI | InChI=1S/C11H14O6.C6H4O2/c1-6-4-7(9(12)13)8(16-2)11(5-6,17-3)10(14)15;7-5-1-2-6(8)4-3-5/h4-5,8H,1-3H3,(H,12,13)(H,14,15);1-4H |
| InChIKey | WAQDARVNJLXRMW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|