C12H19NO3 — CID 151748135
N-(6,6-dimethoxy-4-methylcyclohexa-2,4-dien-1-yl)-N-methylacetamide (PubChem CID 151748135) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-(6,6-dimethoxy-4-methylcyclohexa-2,4-dien-1-yl)-N-methylacetamide.
| Compound Name | N-(6,6-dimethoxy-4-methylcyclohexa-2,4-dien-1-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 151748135 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N-(6,6-dimethoxy-4-methylcyclohexa-2,4-dien-1-yl)-N-methylacetamide |
| SMILES | COC1(OC)C=C(C)C=CC1N(C)C(C)=O |
| InChI | InChI=1S/C12H19NO3/c1-9-6-7-11(13(3)10(2)14)12(8-9,15-4)16-5/h6-8,11H,1-5H3 |
| InChIKey | RNYFWBSLZWJXKR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|