C19H28N2O2 — CID 141194204
[(1R,2S)-2-[(4-phenylpiperidin-1-yl)methyl]cyclohexyl]carbamic acid (PubChem CID 141194204) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is [(1R,2S)-2-[(4-phenylpiperidin-1-yl)methyl]cyclohexyl]carbamic acid.
| Compound Name | [(1R,2S)-2-[(4-phenylpiperidin-1-yl)methyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 141194204 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(1R,2S)-2-[(4-phenylpiperidin-1-yl)methyl]cyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCCC[C@H]1CN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H28N2O2/c22-19(23)20-18-9-5-4-8-17(18)14-21-12-10-16(11-13-21)15-6-2-1-3-7-15/h1-3,6-7,16-18,20H,4-5,8-14H2,(H,22,23)/t17-,18+/m0/s1 |
| InChIKey | ZGMBAKHCWWTBKA-ZWKOTPCHSA-N |
| XLogP | 3.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |