C13H17ClN6 — CID 141194236
1-[1-[2-(3-chlorophenyl)tetrazol-5-yl]ethyl]-1,3-diazinane (PubChem CID 141194236) has the molecular formula C13H17ClN6 and a molecular weight of 292.77 g/mol. Its IUPAC name is 1-[1-[2-(3-chlorophenyl)tetrazol-5-yl]ethyl]-1,3-diazinane.
| Compound Name | 1-[1-[2-(3-chlorophenyl)tetrazol-5-yl]ethyl]-1,3-diazinane |
|---|---|
| PubChem CID | 141194236 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 1-[1-[2-(3-chlorophenyl)tetrazol-5-yl]ethyl]-1,3-diazinane |
| SMILES | CC(c1nnn(-c2cccc(Cl)c2)n1)N1CCCNC1 |
| InChI | InChI=1S/C13H17ClN6/c1-10(19-7-3-6-15-9-19)13-16-18-20(17-13)12-5-2-4-11(14)8-12/h2,4-5,8,10,15H,3,6-7,9H2,1H3 |
| InChIKey | SBCNEVMGGVGTEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |