C14H17ClN6 — CID 69205005
6-[2-(3-chlorophenyl)tetrazol-5-yl]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine (PubChem CID 69205005) has the molecular formula C14H17ClN6 and a molecular weight of 304.78 g/mol. Its IUPAC name is 6-[2-(3-chlorophenyl)tetrazol-5-yl]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 6-[2-(3-chlorophenyl)tetrazol-5-yl]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 69205005 |
| Molecular Formula | C14H17ClN6 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 6-[2-(3-chlorophenyl)tetrazol-5-yl]-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazine |
| SMILES | Clc1cccc(-n2nnc(C3CCC4CNCCN43)n2)c1 |
| InChI | InChI=1S/C14H17ClN6/c15-10-2-1-3-11(8-10)21-18-14(17-19-21)13-5-4-12-9-16-6-7-20(12)13/h1-3,8,12-13,16H,4-7,9H2 |
| InChIKey | WUUCFRABBATYCV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |