C21H24N4O3 — CID 141195742
2,6-dimethoxy-4-[3-(3-methoxyphenyl)piperazin-1-yl]quinazoline (PubChem CID 141195742) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 2,6-dimethoxy-4-[3-(3-methoxyphenyl)piperazin-1-yl]quinazoline.
| Compound Name | 2,6-dimethoxy-4-[3-(3-methoxyphenyl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 141195742 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 2,6-dimethoxy-4-[3-(3-methoxyphenyl)piperazin-1-yl]quinazoline |
| SMILES | COc1cccc(C2CN(c3nc(OC)nc4ccc(OC)cc34)CCN2)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-26-15-6-4-5-14(11-15)19-13-25(10-9-22-19)20-17-12-16(27-2)7-8-18(17)23-21(24-20)28-3/h4-8,11-12,19,22H,9-10,13H2,1-3H3 |
| InChIKey | QHKHVIZHFWKGTA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |