C20H22N4 — CID 143607812
6,7-dimethyl-4-[(3R)-3-phenylpiperazin-1-yl]quinazoline (PubChem CID 143607812) has the molecular formula C20H22N4 and a molecular weight of 318.42 g/mol. Its IUPAC name is 6,7-dimethyl-4-[(3R)-3-phenylpiperazin-1-yl]quinazoline.
| Compound Name | 6,7-dimethyl-4-[(3R)-3-phenylpiperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 143607812 |
| Molecular Formula | C20H22N4 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 6,7-dimethyl-4-[(3R)-3-phenylpiperazin-1-yl]quinazoline |
| SMILES | Cc1cc2ncnc(N3CCN[C@H](c4ccccc4)C3)c2cc1C |
| InChI | InChI=1S/C20H22N4/c1-14-10-17-18(11-15(14)2)22-13-23-20(17)24-9-8-21-19(12-24)16-6-4-3-5-7-16/h3-7,10-11,13,19,21H,8-9,12H2,1-2H3/t19-/m0/s1 |
| InChIKey | NWFFIAVYZUWNRF-IBGZPJMESA-N |
| XLogP | 3.40 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |