C22H21F3N4O4 — CID 140519406
[6,7-dimethoxy-4-(3-phenylpiperazin-1-yl)quinazolin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140519406) has the molecular formula C22H21F3N4O4 and a molecular weight of 462.43 g/mol. Its IUPAC name is [6,7-dimethoxy-4-(3-phenylpiperazin-1-yl)quinazolin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [6,7-dimethoxy-4-(3-phenylpiperazin-1-yl)quinazolin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140519406 |
| Molecular Formula | C22H21F3N4O4 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [6,7-dimethoxy-4-(3-phenylpiperazin-1-yl)quinazolin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc2nc(OC(=O)C(F)(F)F)nc(N3CCNC(c4ccccc4)C3)c2cc1OC |
| InChI | InChI=1S/C22H21F3N4O4/c1-31-17-10-14-15(11-18(17)32-2)27-21(33-20(30)22(23,24)25)28-19(14)29-9-8-26-16(12-29)13-6-4-3-5-7-13/h3-7,10-11,16,26H,8-9,12H2,1-2H3 |
| InChIKey | KYLBWVRZCBSMHT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |