C31H23F3N4O5 — CID 140549603
[4-(4-benzamidoanilino)-6-methoxy-7-phenylmethoxyquinazolin-2-yl] 2,2,2-trifluoroacetate (PubChem CID 140549603) has the molecular formula C31H23F3N4O5 and a molecular weight of 588.54 g/mol. Its IUPAC name is [4-(4-benzamidoanilino)-6-methoxy-7-phenylmethoxyquinazolin-2-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(4-benzamidoanilino)-6-methoxy-7-phenylmethoxyquinazolin-2-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 140549603 |
| Molecular Formula | C31H23F3N4O5 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | [4-(4-benzamidoanilino)-6-methoxy-7-phenylmethoxyquinazolin-2-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cc2c(Nc3ccc(NC(=O)c4ccccc4)cc3)nc(OC(=O)C(F)(F)F)nc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C31H23F3N4O5/c1-41-25-16-23-24(17-26(25)42-18-19-8-4-2-5-9-19)37-30(43-29(40)31(32,33)34)38-27(23)35-21-12-14-22(15-13-21)36-28(39)20-10-6-3-7-11-20/h2-17H,18H2,1H3,(H,36,39)(H,35,37,38) |
| InChIKey | RZHZOQMHQQWWMQ-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |