C26H21FO7 — CID 141197210
[(2R,3S,4S,5R)-3,5-dibenzoyl-4-fluoro-3,5-dihydroxyoxolan-2-yl]methyl benzoate (PubChem CID 141197210) has the molecular formula C26H21FO7 and a molecular weight of 464.45 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,5-dibenzoyl-4-fluoro-3,5-dihydroxyoxolan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R)-3,5-dibenzoyl-4-fluoro-3,5-dihydroxyoxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 141197210 |
| Molecular Formula | C26H21FO7 |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | [(2R,3S,4S,5R)-3,5-dibenzoyl-4-fluoro-3,5-dihydroxyoxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@](O)(C(=O)c2ccccc2)[C@@H](F)[C@@]1(O)C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H21FO7/c27-24-25(31,21(28)17-10-4-1-5-11-17)20(16-33-23(30)19-14-8-3-9-15-19)34-26(24,32)22(29)18-12-6-2-7-13-18/h1-15,20,24,31-32H,16H2/t20-,24+,25+,26-/m1/s1 |
| InChIKey | GGRDHCNJQDRROV-IFKAHUTRSA-N |
| XLogP | 2.77 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |