C13H16O2 — CID 141197729
(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3-phenylpropan-1-ol (PubChem CID 141197729) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3-phenylpropan-1-ol.
| Compound Name | (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 141197729 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-3-phenylpropan-1-ol |
| SMILES | OC[C@@H](Cc1ccccc1)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C13H16O2/c14-10-12(13-7-4-8-15-13)9-11-5-2-1-3-6-11/h1-7,12-14H,8-10H2/t12-,13+/m1/s1 |
| InChIKey | DVPDIGYKHVXURY-OLZOCXBDSA-N |
| XLogP | 1.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|