C15H19NO4 — CID 91129411
benzyl N-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxyethyl]carbamate (PubChem CID 91129411) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is benzyl N-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxyethyl]carbamate.
| Compound Name | benzyl N-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxyethyl]carbamate |
|---|---|
| PubChem CID | 91129411 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | benzyl N-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-methoxyethyl]carbamate |
| SMILES | CO[C@H](CNC(=O)OCc1ccccc1)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C15H19NO4/c1-18-14(13-8-5-9-19-13)10-16-15(17)20-11-12-6-3-2-4-7-12/h2-8,13-14H,9-11H2,1H3,(H,16,17)/t13-,14+/m0/s1 |
| InChIKey | NRDGVTYYLIVCJE-UONOGXRCSA-N |
| XLogP | 1.88 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|