C18H25NO5 — CID 91510051
benzyl N-[(2R)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl]carbamate (PubChem CID 91510051) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is benzyl N-[(2R)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl]carbamate.
| Compound Name | benzyl N-[(2R)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 91510051 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | benzyl N-[(2R)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-[(2-methylpropan-2-yl)oxy]ethyl]carbamate |
| SMILES | CC(C)(C)O[C@H](CNC(=O)OCc1ccccc1)[C@H]1OC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C18H25NO5/c1-18(2,3)24-13(15-16-14(23-16)11-21-15)9-19-17(20)22-10-12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3,(H,19,20)/t13-,14+,15-,16+/m1/s1 |
| InChIKey | NVRNJZJRCBVZCS-QXSJWSMHSA-N |
| XLogP | 2.26 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|