C15H19NO5 — CID 90986030
[(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] N-benzylcarbamate (PubChem CID 90986030) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] N-benzylcarbamate.
| Compound Name | [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] N-benzylcarbamate |
|---|---|
| PubChem CID | 90986030 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] N-benzylcarbamate |
| SMILES | CO[C@@H](COC(=O)NCc1ccccc1)[C@H]1OC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C15H19NO5/c1-18-11(13-14-12(21-14)9-19-13)8-20-15(17)16-7-10-5-3-2-4-6-10/h2-6,11-14H,7-9H2,1H3,(H,16,17)/t11-,12-,13+,14-/m0/s1 |
| InChIKey | WPDAXPFFZXNLRQ-FQUUOJAGSA-N |
| XLogP | 1.09 |
| TPSA | 69.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|