C22H23NO5 — CID 87402250
[1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-(9H-fluoren-9-yl)-1-methoxypropan-2-yl] carbamate (PubChem CID 87402250) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is [1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-(9H-fluoren-9-yl)-1-methoxypropan-2-yl] carbamate.
| Compound Name | [1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-(9H-fluoren-9-yl)-1-methoxypropan-2-yl] carbamate |
|---|---|
| PubChem CID | 87402250 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-3-(9H-fluoren-9-yl)-1-methoxypropan-2-yl] carbamate |
| SMILES | COC(C(CC1c2ccccc2-c2ccccc21)OC(N)=O)[C@H]1OC[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C22H23NO5/c1-25-19(21-20-18(27-20)11-26-21)17(28-22(23)24)10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16/h2-9,16-21H,10-11H2,1H3,(H2,23,24)/t17?,18-,19?,20-,21-/m1/s1 |
| InChIKey | JQWDGYJEJAAOAT-SSXNTNPLSA-N |
| XLogP | 2.83 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|