C15H19NO5 — CID 87402008
[(1R)-1-[(1S,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate (PubChem CID 87402008) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is [(1R)-1-[(1S,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate.
| Compound Name | [(1R)-1-[(1S,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 87402008 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | [(1R)-1-[(1S,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-1-methoxy-3-phenylpropan-2-yl] carbamate |
| SMILES | CO[C@H](C(Cc1ccccc1)OC(N)=O)[C@H]1OC[C@H]2O[C@H]12 |
| InChI | InChI=1S/C15H19NO5/c1-18-12(14-13-11(20-13)8-19-14)10(21-15(16)17)7-9-5-3-2-4-6-9/h2-6,10-14H,7-8H2,1H3,(H2,16,17)/t10?,11-,12-,13+,14-/m1/s1 |
| InChIKey | DIMQULXUVYGDRR-URSGVKGYSA-N |
| XLogP | 0.87 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|