C8H13NO5 — CID 87479581
[(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] carbamate (PubChem CID 87479581) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] carbamate.
| Compound Name | [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] carbamate |
|---|---|
| PubChem CID | 87479581 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | [(2S)-2-[(1S,2R,5S)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]-2-methoxyethyl] carbamate |
| SMILES | CO[C@@H](COC(N)=O)[C@H]1OC[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C8H13NO5/c1-11-4(2-13-8(9)10)6-7-5(14-7)3-12-6/h4-7H,2-3H2,1H3,(H2,9,10)/t4-,5-,6+,7-/m0/s1 |
| InChIKey | LPHJNTDCDYQIEE-YTLHQDLWSA-N |
| XLogP | -0.74 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|