C6H10O4 — CID 130761579
(1R)-1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethane-1,2-diol (PubChem CID 130761579) has the molecular formula C6H10O4 and a molecular weight of 146.14 g/mol. Its IUPAC name is (1R)-1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 130761579 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (1R)-1-[(1R,2R,5R)-3,6-dioxabicyclo[3.1.0]hexan-2-yl]ethane-1,2-diol |
| SMILES | OC[C@@H](O)[C@H]1OC[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C6H10O4/c7-1-3(8)5-6-4(10-6)2-9-5/h3-8H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| InChIKey | NLUOHXZCIXXLMZ-KVTDHHQDSA-N |
| XLogP | -1.49 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|