C15H19NO6S — CID 90887193
(3S)-3-[(2S)-2,5-dihydrofuran-2-yl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid (PubChem CID 90887193) has the molecular formula C15H19NO6S and a molecular weight of 341.39 g/mol. Its IUPAC name is (3S)-3-[(2S)-2,5-dihydrofuran-2-yl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid.
| Compound Name | (3S)-3-[(2S)-2,5-dihydrofuran-2-yl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90887193 |
| Molecular Formula | C15H19NO6S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (3S)-3-[(2S)-2,5-dihydrofuran-2-yl]-3-(phenylmethoxycarbonylamino)propane-1-sulfonic acid |
| SMILES | O=C(N[C@@H](CCS(=O)(=O)O)[C@@H]1C=CCO1)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO6S/c17-15(22-11-12-5-2-1-3-6-12)16-13(8-10-23(18,19)20)14-7-4-9-21-14/h1-7,13-14H,8-11H2,(H,16,17)(H,18,19,20)/t13-,14-/m0/s1 |
| InChIKey | UWRMPMPSTOOBRB-KBPBESRZSA-N |
| XLogP | 1.51 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|