C21H23NO6S — CID 90097281
2-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-(phenylmethoxycarbonylamino)propyl]benzenesulfonic acid (PubChem CID 90097281) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is 2-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-(phenylmethoxycarbonylamino)propyl]benzenesulfonic acid.
| Compound Name | 2-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-(phenylmethoxycarbonylamino)propyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 90097281 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[(2R)-2-[(2S)-2,5-dihydrofuran-2-yl]-2-(phenylmethoxycarbonylamino)propyl]benzenesulfonic acid |
| SMILES | C[C@](Cc1ccccc1S(=O)(=O)O)(NC(=O)OCc1ccccc1)[C@@H]1C=CCO1 |
| InChI | InChI=1S/C21H23NO6S/c1-21(19-12-7-13-27-19,14-17-10-5-6-11-18(17)29(24,25)26)22-20(23)28-15-16-8-3-2-4-9-16/h2-12,19H,13-15H2,1H3,(H,22,23)(H,24,25,26)/t19-,21+/m0/s1 |
| InChIKey | JIUXZIJYXFUUEY-PZJWPPBQSA-N |
| XLogP | 3.12 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|