C14H17IO3 — CID 141198603
4-(iodomethyl)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxole (PubChem CID 141198603) has the molecular formula C14H17IO3 and a molecular weight of 360.19 g/mol. Its IUPAC name is 4-(iodomethyl)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxole.
| Compound Name | 4-(iodomethyl)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxole |
|---|---|
| PubChem CID | 141198603 |
| Molecular Formula | C14H17IO3 |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 4-(iodomethyl)-2,2-dimethyl-5-(phenylmethoxymethyl)-1,3-dioxole |
| SMILES | CC1(C)OC(CI)=C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C14H17IO3/c1-14(2)17-12(8-15)13(18-14)10-16-9-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3 |
| InChIKey | HKEVMECHWRUUFX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|