C23H28N6O3S — CID 141199775
N-(4-morpholin-4-ylsulfonylphenyl)-4-(5-piperazin-1-yl-1H-pyrrol-2-yl)pyridin-2-amine (PubChem CID 141199775) has the molecular formula C23H28N6O3S and a molecular weight of 468.58 g/mol. Its IUPAC name is N-(4-morpholin-4-ylsulfonylphenyl)-4-(5-piperazin-1-yl-1H-pyrrol-2-yl)pyridin-2-amine.
| Compound Name | N-(4-morpholin-4-ylsulfonylphenyl)-4-(5-piperazin-1-yl-1H-pyrrol-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 141199775 |
| Molecular Formula | C23H28N6O3S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | N-(4-morpholin-4-ylsulfonylphenyl)-4-(5-piperazin-1-yl-1H-pyrrol-2-yl)pyridin-2-amine |
| SMILES | O=S(=O)(c1ccc(Nc2cc(-c3ccc(N4CCNCC4)[nH]3)ccn2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C23H28N6O3S/c30-33(31,29-13-15-32-16-14-29)20-3-1-19(2-4-20)26-22-17-18(7-8-25-22)21-5-6-23(27-21)28-11-9-24-10-12-28/h1-8,17,24,27H,9-16H2,(H,25,26) |
| InChIKey | JQJPUSLAFVHQIO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 102.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |