C14H21N5Si — CID 141201394
[6-(2-triethylsilylethynyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanamine (PubChem CID 141201394) has the molecular formula C14H21N5Si and a molecular weight of 287.44 g/mol. Its IUPAC name is [6-(2-triethylsilylethynyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanamine.
| Compound Name | [6-(2-triethylsilylethynyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanamine |
|---|---|
| PubChem CID | 141201394 |
| Molecular Formula | C14H21N5Si |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | [6-(2-triethylsilylethynyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]methanamine |
| SMILES | CC[Si](C#Cc1ccc2nnc(CN)n2n1)(CC)CC |
| InChI | InChI=1S/C14H21N5Si/c1-4-20(5-2,6-3)10-9-12-7-8-13-16-17-14(11-15)19(13)18-12/h7-8H,4-6,11,15H2,1-3H3 |
| InChIKey | YSHNXUIERULHLX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|