C19H21NO3S — CID 141202466
2-[5-(3-aminopropyl)-3-methylsulfanyl-1-benzofuran-2-yl]-5-methoxyphenol (PubChem CID 141202466) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 2-[5-(3-aminopropyl)-3-methylsulfanyl-1-benzofuran-2-yl]-5-methoxyphenol.
| Compound Name | 2-[5-(3-aminopropyl)-3-methylsulfanyl-1-benzofuran-2-yl]-5-methoxyphenol |
|---|---|
| PubChem CID | 141202466 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 2-[5-(3-aminopropyl)-3-methylsulfanyl-1-benzofuran-2-yl]-5-methoxyphenol |
| SMILES | COc1ccc(-c2oc3ccc(CCCN)cc3c2SC)c(O)c1 |
| InChI | InChI=1S/C19H21NO3S/c1-22-13-6-7-14(16(21)11-13)18-19(24-2)15-10-12(4-3-9-20)5-8-17(15)23-18/h5-8,10-11,21H,3-4,9,20H2,1-2H3 |
| InChIKey | INVOBIHBBPSEMS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |