C19H18O5S — CID 24946848
methyl 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-5-yl]acetate (PubChem CID 24946848) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is methyl 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-5-yl]acetate.
| Compound Name | methyl 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-5-yl]acetate |
|---|---|
| PubChem CID | 24946848 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | methyl 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-5-yl]acetate |
| SMILES | COC(=O)Cc1ccc2oc(-c3ccc(O)c(OC)c3)c(SC)c2c1 |
| InChI | InChI=1S/C19H18O5S/c1-22-16-10-12(5-6-14(16)20)18-19(25-3)13-8-11(9-17(21)23-2)4-7-15(13)24-18/h4-8,10,20H,9H2,1-3H3 |
| InChIKey | HXYFRGJIZUVGAD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |