C19H20O4S — CID 24946152
2-methoxy-4-[5-(2-methoxyethyl)-3-methylsulfanyl-1-benzofuran-2-yl]phenol (PubChem CID 24946152) has the molecular formula C19H20O4S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2-methoxy-4-[5-(2-methoxyethyl)-3-methylsulfanyl-1-benzofuran-2-yl]phenol.
| Compound Name | 2-methoxy-4-[5-(2-methoxyethyl)-3-methylsulfanyl-1-benzofuran-2-yl]phenol |
|---|---|
| PubChem CID | 24946152 |
| Molecular Formula | C19H20O4S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-methoxy-4-[5-(2-methoxyethyl)-3-methylsulfanyl-1-benzofuran-2-yl]phenol |
| SMILES | COCCc1ccc2oc(-c3ccc(O)c(OC)c3)c(SC)c2c1 |
| InChI | InChI=1S/C19H20O4S/c1-21-9-8-12-4-7-16-14(10-12)19(24-3)18(23-16)13-5-6-15(20)17(11-13)22-2/h4-7,10-11,20H,8-9H2,1-3H3 |
| InChIKey | CSYUMUOEPNGQSA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |