C22H26O5S — CID 24946510
2-[3-methoxy-4-(methoxymethoxy)phenyl]-5-(3-methoxypropyl)-3-methylsulfanyl-1-benzofuran (PubChem CID 24946510) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is 2-[3-methoxy-4-(methoxymethoxy)phenyl]-5-(3-methoxypropyl)-3-methylsulfanyl-1-benzofuran.
| Compound Name | 2-[3-methoxy-4-(methoxymethoxy)phenyl]-5-(3-methoxypropyl)-3-methylsulfanyl-1-benzofuran |
|---|---|
| PubChem CID | 24946510 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 2-[3-methoxy-4-(methoxymethoxy)phenyl]-5-(3-methoxypropyl)-3-methylsulfanyl-1-benzofuran |
| SMILES | COCCCc1ccc2oc(-c3ccc(OCOC)c(OC)c3)c(SC)c2c1 |
| InChI | InChI=1S/C22H26O5S/c1-23-11-5-6-15-7-9-18-17(12-15)22(28-4)21(27-18)16-8-10-19(26-14-24-2)20(13-16)25-3/h7-10,12-13H,5-6,11,14H2,1-4H3 |
| InChIKey | DEJIUZKSRIHWGM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|