C19H18O5S — CID 91430647
2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-4-yl]propanoic acid (PubChem CID 91430647) has the molecular formula C19H18O5S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-4-yl]propanoic acid.
| Compound Name | 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-4-yl]propanoic acid |
|---|---|
| PubChem CID | 91430647 |
| Molecular Formula | C19H18O5S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-[2-(4-hydroxy-3-methoxyphenyl)-3-methylsulfanyl-1-benzofuran-4-yl]propanoic acid |
| SMILES | COc1cc(-c2oc3cccc(C(C)C(=O)O)c3c2SC)ccc1O |
| InChI | InChI=1S/C19H18O5S/c1-10(19(21)22)12-5-4-6-14-16(12)18(25-3)17(24-14)11-7-8-13(20)15(9-11)23-2/h4-10,20H,1-3H3,(H,21,22) |
| InChIKey | JUCPXMKTEROVEO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |