C21H18O7 — CID 155202302
(E)-3-[4,5-bis(4-hydroxy-3-methoxyphenyl)furan-2-yl]prop-2-enoic acid (PubChem CID 155202302) has the molecular formula C21H18O7 and a molecular weight of 382.37 g/mol. Its IUPAC name is (E)-3-[4,5-bis(4-hydroxy-3-methoxyphenyl)furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4,5-bis(4-hydroxy-3-methoxyphenyl)furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 155202302 |
| Molecular Formula | C21H18O7 |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | (E)-3-[4,5-bis(4-hydroxy-3-methoxyphenyl)furan-2-yl]prop-2-enoic acid |
| SMILES | COc1cc(-c2cc(/C=C/C(=O)O)oc2-c2ccc(O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C21H18O7/c1-26-18-9-12(3-6-16(18)22)15-11-14(5-8-20(24)25)28-21(15)13-4-7-17(23)19(10-13)27-2/h3-11,22-23H,1-2H3,(H,24,25)/b8-5+ |
| InChIKey | OMSKDSAFNUXQMC-VMPITWQZSA-N |
| XLogP | 4.14 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|