About cycloheptene-1,3-diamine
cycloheptene-1,3-diamine (PubChem CID 141202628) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is cycloheptene-1,3-diamine.
Molecular Properties
| Compound Name | cycloheptene-1,3-diamine |
| PubChem CID | 141202628 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | cycloheptene-1,3-diamine |
| SMILES | NC1=CC(N)CCCC1 |
| InChI | InChI=1S/C7H14N2/c8-6-3-1-2-4-7(9)5-6/h5-6H,1-4,8-9H2 |
| InChIKey | JKMIDQQFBXZOCS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cycloheptene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptene-1,3-diamine?
The IUPAC name of cycloheptene-1,3-diamine (CID 141202628) is cycloheptene-1,3-diamine.
What is the SMILES notation for cycloheptene-1,3-diamine?
The canonical SMILES for cycloheptene-1,3-diamine is NC1=CC(N)CCCC1.
What is the InChIKey of cycloheptene-1,3-diamine?
The InChIKey is JKMIDQQFBXZOCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c8-6-3-1-2-4-7(9)5-6/h5-6H,1-4,8-9H2.
What are the key properties of cycloheptene-1,3-diamine?
cycloheptene-1,3-diamine has a molecular weight of 126.20 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptene-1,3-diamine is sourced from PubChem (CID 141202628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).