C22H16Cl2F3NO — CID 141204479
3-(3-chlorophenyl)-1-(4-chlorophenyl)-3-(3,4,5-trifluoro-2-methylanilino)propan-1-one (PubChem CID 141204479) has the molecular formula C22H16Cl2F3NO and a molecular weight of 438.28 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-(4-chlorophenyl)-3-(3,4,5-trifluoro-2-methylanilino)propan-1-one.
| Compound Name | 3-(3-chlorophenyl)-1-(4-chlorophenyl)-3-(3,4,5-trifluoro-2-methylanilino)propan-1-one |
|---|---|
| PubChem CID | 141204479 |
| Molecular Formula | C22H16Cl2F3NO |
| Molecular Weight | 438.28 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 3-(3-chlorophenyl)-1-(4-chlorophenyl)-3-(3,4,5-trifluoro-2-methylanilino)propan-1-one |
| SMILES | Cc1c(NC(CC(=O)c2ccc(Cl)cc2)c2cccc(Cl)c2)cc(F)c(F)c1F |
| InChI | InChI=1S/C22H16Cl2F3NO/c1-12-18(10-17(25)22(27)21(12)26)28-19(14-3-2-4-16(24)9-14)11-20(29)13-5-7-15(23)8-6-13/h2-10,19,28H,11H2,1H3 |
| InChIKey | IFINWKYTPILTPV-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.28 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|