C17H15FN4S — CID 141205506
4-ethynyl-2-fluoro-5-(8-methyl-2-methylsulfanyl-7H-pyrido[2,3-d]pyrimidin-6-yl)aniline (PubChem CID 141205506) has the molecular formula C17H15FN4S and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-ethynyl-2-fluoro-5-(8-methyl-2-methylsulfanyl-7H-pyrido[2,3-d]pyrimidin-6-yl)aniline.
| Compound Name | 4-ethynyl-2-fluoro-5-(8-methyl-2-methylsulfanyl-7H-pyrido[2,3-d]pyrimidin-6-yl)aniline |
|---|---|
| PubChem CID | 141205506 |
| Molecular Formula | C17H15FN4S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 4-ethynyl-2-fluoro-5-(8-methyl-2-methylsulfanyl-7H-pyrido[2,3-d]pyrimidin-6-yl)aniline |
| SMILES | C#Cc1cc(F)c(N)cc1C1=Cc2cnc(SC)nc2N(C)C1 |
| InChI | InChI=1S/C17H15FN4S/c1-4-10-6-14(18)15(19)7-13(10)12-5-11-8-20-17(23-3)21-16(11)22(2)9-12/h1,5-8H,9,19H2,2-3H3 |
| InChIKey | KIAKYIDAUAXVQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|