C17H16FN5S — CID 169074858
2-fluoro-4-methyl-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-7-yl)aniline (PubChem CID 169074858) has the molecular formula C17H16FN5S and a molecular weight of 341.42 g/mol. Its IUPAC name is 2-fluoro-4-methyl-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-7-yl)aniline.
| Compound Name | 2-fluoro-4-methyl-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-7-yl)aniline |
|---|---|
| PubChem CID | 169074858 |
| Molecular Formula | C17H16FN5S |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 2-fluoro-4-methyl-3-(12-methylsulfanyl-2,5,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),5,7,9,11-pentaen-7-yl)aniline |
| SMILES | CSc1ncc2c(n1)N1CCN=C1C(c1c(C)ccc(N)c1F)=C2 |
| InChI | InChI=1S/C17H16FN5S/c1-9-3-4-12(19)14(18)13(9)11-7-10-8-21-17(24-2)22-15(10)23-6-5-20-16(11)23/h3-4,7-8H,5-6,19H2,1-2H3 |
| InChIKey | WXZUYKUKGSQVML-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|