C26H23Cl2NO4 — CID 141206140
4-[(1E,6E)-7-[5-[(2,4-dichlorophenyl)methoxy]-2-nitrophenyl]hepta-1,6-dienyl]phenol (PubChem CID 141206140) has the molecular formula C26H23Cl2NO4 and a molecular weight of 484.38 g/mol. Its IUPAC name is 4-[(1E,6E)-7-[5-[(2,4-dichlorophenyl)methoxy]-2-nitrophenyl]hepta-1,6-dienyl]phenol.
| Compound Name | 4-[(1E,6E)-7-[5-[(2,4-dichlorophenyl)methoxy]-2-nitrophenyl]hepta-1,6-dienyl]phenol |
|---|---|
| PubChem CID | 141206140 |
| Molecular Formula | C26H23Cl2NO4 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 4-[(1E,6E)-7-[5-[(2,4-dichlorophenyl)methoxy]-2-nitrophenyl]hepta-1,6-dienyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(Cl)cc2Cl)cc1/C=C/CCC/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C26H23Cl2NO4/c27-22-11-10-21(25(28)17-22)18-33-24-14-15-26(29(31)32)20(16-24)7-5-3-1-2-4-6-19-8-12-23(30)13-9-19/h4-17,30H,1-3,18H2/b6-4+,7-5+ |
| InChIKey | FJYCIXMKYAFTFS-YDFGWWAZSA-N |
| XLogP | 8.08 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|