C14H9Cl2NO6 — CID 91687263
4-[(2,4-dichlorophenyl)methoxy]-2-hydroxy-5-nitrobenzoic acid (PubChem CID 91687263) has the molecular formula C14H9Cl2NO6 and a molecular weight of 358.13 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-2-hydroxy-5-nitrobenzoic acid.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-2-hydroxy-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 91687263 |
| Molecular Formula | C14H9Cl2NO6 |
| Molecular Weight | 358.13 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-2-hydroxy-5-nitrobenzoic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(OCc2ccc(Cl)cc2Cl)cc1O |
| InChI | InChI=1S/C14H9Cl2NO6/c15-8-2-1-7(10(16)3-8)6-23-13-5-12(18)9(14(19)20)4-11(13)17(21)22/h1-5,18H,6H2,(H,19,20) |
| InChIKey | FHKLPPKVUMGWTG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.13 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|