C24H24N4O2Sn — CID 141207083
tris(4-methylphenyl)stannyl 2-(2H-tetrazol-5-yl)acetate (PubChem CID 141207083) has the molecular formula C24H24N4O2Sn and a molecular weight of 519.19 g/mol. Its IUPAC name is tris(4-methylphenyl)stannyl 2-(2H-tetrazol-5-yl)acetate.
| Compound Name | tris(4-methylphenyl)stannyl 2-(2H-tetrazol-5-yl)acetate |
|---|---|
| PubChem CID | 141207083 |
| Molecular Formula | C24H24N4O2Sn |
| Molecular Weight | 519.19 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | tris(4-methylphenyl)stannyl 2-(2H-tetrazol-5-yl)acetate |
| SMILES | Cc1ccc([Sn](OC(=O)Cc2nn[nH]n2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C7H7.C3H4N4O2.Sn/c3*1-7-5-3-2-4-6-7;8-3(9)1-2-4-6-7-5-2;/h3*3-6H,1H3;1H2,(H,8,9)(H,4,5,6,7);/q;;;;+1/p-1 |
| InChIKey | NMCYJAGXXNMMOF-UHFFFAOYSA-M |
| XLogP | 1.88 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |