About iron;2-(2H-tetrazol-5-yl)acetic acid;zinc
iron;2-(2H-tetrazol-5-yl)acetic acid;zinc (PubChem CID 175714955) has the molecular formula C3H4FeN4O2Zn
and a molecular weight of 249.33 g/mol. Its IUPAC name is iron;2-(2H-tetrazol-5-yl)acetic acid;zinc.
Molecular Properties
| Compound Name | iron;2-(2H-tetrazol-5-yl)acetic acid;zinc |
| PubChem CID | 175714955 |
| Molecular Formula | C3H4FeN4O2Zn |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 247.90 |
| IUPAC Name | iron;2-(2H-tetrazol-5-yl)acetic acid;zinc |
| SMILES | O=C(O)Cc1nn[nH]n1.[Fe].[Zn] |
| InChI | InChI=1S/C3H4N4O2.Fe.Zn/c8-3(9)1-2-4-6-7-5-2;;/h1H2,(H,8,9)(H,4,5,6,7);; |
| InChIKey | RDSHQEWYBZYZOK-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;2-(2H-tetrazol-5-yl)acetic acid;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-(2H-tetrazol-5-yl)acetic acid;zinc?
The IUPAC name of iron;2-(2H-tetrazol-5-yl)acetic acid;zinc (CID 175714955) is iron;2-(2H-tetrazol-5-yl)acetic acid;zinc.
What is the SMILES notation for iron;2-(2H-tetrazol-5-yl)acetic acid;zinc?
The canonical SMILES for iron;2-(2H-tetrazol-5-yl)acetic acid;zinc is O=C(O)Cc1nn[nH]n1.[Fe].[Zn].
What is the InChIKey of iron;2-(2H-tetrazol-5-yl)acetic acid;zinc?
The InChIKey is RDSHQEWYBZYZOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O2.Fe.Zn/c8-3(9)1-2-4-6-7-5-2;;/h1H2,(H,8,9)(H,4,5,6,7);;.
What are the key properties of iron;2-(2H-tetrazol-5-yl)acetic acid;zinc?
iron;2-(2H-tetrazol-5-yl)acetic acid;zinc has a molecular weight of 249.33 g/mol, XLogP of -1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-(2H-tetrazol-5-yl)acetic acid;zinc is sourced from PubChem (CID 175714955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).