2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid

C6H7N5O4 — CID 159042084

IUPAC2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid
SMILESN#CCC(=O)O.O=C(O)Cc1nn[nH]n1
InChIInChI=1S/C3H4N4O2.C3H3NO2/c8-3(9)1-2-4-6-7-5-2;4-2-1-3(5)6/h1H2,(H,8,9)(H,4,5,6,7);1H2,(H,5,6)
InChIKeyJWENQJDSXFWWIN-UHFFFAOYSA-N
MW213.15 g/mol
LogP-1.19
Rot. Bonds3

About 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid

2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid (PubChem CID 159042084) has the molecular formula C6H7N5O4 and a molecular weight of 213.15 g/mol. Its IUPAC name is 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid.

Molecular Properties

Compound Name2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid
PubChem CID159042084
Molecular FormulaC6H7N5O4
Molecular Weight213.15 g/mol
Exact Mass213.05
IUPAC Name2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid
SMILESN#CCC(=O)O.O=C(O)Cc1nn[nH]n1
InChIInChI=1S/C3H4N4O2.C3H3NO2/c8-3(9)1-2-4-6-7-5-2;4-2-1-3(5)6/h1H2,(H,8,9)(H,4,5,6,7);1H2,(H,5,6)
InChIKeyJWENQJDSXFWWIN-UHFFFAOYSA-N
XLogP-1.19
TPSA152.85 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.15
LogP ≤ 5-1.19
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Analyze 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid?
The IUPAC name of 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid (CID 159042084) is 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid.
What is the SMILES notation for 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid?
The canonical SMILES for 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid is N#CCC(=O)O.O=C(O)Cc1nn[nH]n1.
What is the InChIKey of 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid?
The InChIKey is JWENQJDSXFWWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N4O2.C3H3NO2/c8-3(9)1-2-4-6-7-5-2;4-2-1-3(5)6/h1H2,(H,8,9)(H,4,5,6,7);1H2,(H,5,6).
What are the key properties of 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid?
2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid has a molecular weight of 213.15 g/mol, XLogP of -1.19, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetic acid;2-(2H-tetrazol-5-yl)acetic acid is sourced from PubChem (CID 159042084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).