About bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine
bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine (PubChem CID 139075598) has the molecular formula C16H14N4O4
and a molecular weight of 326.31 g/mol. Its IUPAC name is bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine |
| PubChem CID | 139075598 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine |
| SMILES | N#CCC(=O)O.N#CCC(=O)O.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.2C3H3NO2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*4-2-1-3(5)6/h1-8H;2*1H2,(H,5,6) |
| InChIKey | KUSPCTGQKUIWCD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 147.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine?
The IUPAC name of bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine (CID 139075598) is bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine.
What is the SMILES notation for bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine?
The canonical SMILES for bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine is N#CCC(=O)O.N#CCC(=O)O.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine?
The InChIKey is KUSPCTGQKUIWCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2C3H3NO2/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*4-2-1-3(5)6/h1-8H;2*1H2,(H,5,6).
What are the key properties of bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine?
bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine has a molecular weight of 326.31 g/mol, XLogP of 2.11, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-cyanoacetic acid);4-pyridin-4-ylpyridine is sourced from PubChem (CID 139075598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).