About 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine
3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine (PubChem CID 141207116) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine.
Molecular Properties
| Compound Name | 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine |
| PubChem CID | 141207116 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine |
| SMILES | CCCCN1CC=C(C(C)C)OC1 |
| InChI | InChI=1S/C11H21NO/c1-4-5-7-12-8-6-11(10(2)3)13-9-12/h6,10H,4-5,7-9H2,1-3H3 |
| InChIKey | YMKMSQYGUBOKDW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine?
The IUPAC name of 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine (CID 141207116) is 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine.
What is the SMILES notation for 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine?
The canonical SMILES for 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine is CCCCN1CC=C(C(C)C)OC1.
What is the InChIKey of 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine?
The InChIKey is YMKMSQYGUBOKDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-4-5-7-12-8-6-11(10(2)3)13-9-12/h6,10H,4-5,7-9H2,1-3H3.
What are the key properties of 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine?
3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine has a molecular weight of 183.29 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-6-propan-2-yl-2,4-dihydro-1,3-oxazine is sourced from PubChem (CID 141207116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).