C21H24F3N3Si — CID 141208592
trimethyl-[2-[6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]-3-pyridinyl]ethynyl]silane (PubChem CID 141208592) has the molecular formula C21H24F3N3Si and a molecular weight of 403.52 g/mol. Its IUPAC name is trimethyl-[2-[6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]-3-pyridinyl]ethynyl]silane.
| Compound Name | trimethyl-[2-[6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]-3-pyridinyl]ethynyl]silane |
|---|---|
| PubChem CID | 141208592 |
| Molecular Formula | C21H24F3N3Si |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | trimethyl-[2-[6-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]-3-pyridinyl]ethynyl]silane |
| SMILES | C[Si](C)(C)C#Cc1ccc(N2CCN(c3ccccc3C(F)(F)F)CC2)nc1 |
| InChI | InChI=1S/C21H24F3N3Si/c1-28(2,3)15-10-17-8-9-20(25-16-17)27-13-11-26(12-14-27)19-7-5-4-6-18(19)21(22,23)24/h4-9,16H,11-14H2,1-3H3 |
| InChIKey | CSZJTTVVZWEIJS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|