C20H20F3N3O2 — CID 170873040
(E)-2-methyl-3-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]prop-2-enoic acid (PubChem CID 170873040) has the molecular formula C20H20F3N3O2 and a molecular weight of 391.39 g/mol. Its IUPAC name is (E)-2-methyl-3-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-methyl-3-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170873040 |
| Molecular Formula | C20H20F3N3O2 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (E)-2-methyl-3-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]prop-2-enoic acid |
| SMILES | C/C(=C\c1ccccc1N1CCN(c2ccc(C(F)(F)F)cn2)CC1)C(=O)O |
| InChI | InChI=1S/C20H20F3N3O2/c1-14(19(27)28)12-15-4-2-3-5-17(15)25-8-10-26(11-9-25)18-7-6-16(13-24-18)20(21,22)23/h2-7,12-13H,8-11H2,1H3,(H,27,28)/b14-12+ |
| InChIKey | HEDCHDAQLZMAKE-WYMLVPIESA-N |
| XLogP | 3.91 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|