C24H23F3N4O — CID 73002357
N-benzyl-1-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]methanimine oxide (PubChem CID 73002357) has the molecular formula C24H23F3N4O and a molecular weight of 440.47 g/mol. Its IUPAC name is N-benzyl-1-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]methanimine oxide.
| Compound Name | N-benzyl-1-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]methanimine oxide |
|---|---|
| PubChem CID | 73002357 |
| Molecular Formula | C24H23F3N4O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-benzyl-1-[2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]phenyl]methanimine oxide |
| SMILES | [O-][N+](=Cc1ccccc1N1CCN(c2ccc(C(F)(F)F)cn2)CC1)Cc1ccccc1 |
| InChI | InChI=1S/C24H23F3N4O/c25-24(26,27)21-10-11-23(28-16-21)30-14-12-29(13-15-30)22-9-5-4-8-20(22)18-31(32)17-19-6-2-1-3-7-19/h1-11,16,18H,12-15,17H2 |
| InChIKey | ZPSPWVOPTZCBEV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 45.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|