C16H22N2OSi — CID 141314261
3,3-dimethyl-1-[5-(2-trimethylsilylethynyl)-2-pyridinyl]pyrrolidin-2-one (PubChem CID 141314261) has the molecular formula C16H22N2OSi and a molecular weight of 286.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-[5-(2-trimethylsilylethynyl)-2-pyridinyl]pyrrolidin-2-one.
| Compound Name | 3,3-dimethyl-1-[5-(2-trimethylsilylethynyl)-2-pyridinyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 141314261 |
| Molecular Formula | C16H22N2OSi |
| Molecular Weight | 286.45 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 3,3-dimethyl-1-[5-(2-trimethylsilylethynyl)-2-pyridinyl]pyrrolidin-2-one |
| SMILES | CC1(C)CCN(c2ccc(C#C[Si](C)(C)C)cn2)C1=O |
| InChI | InChI=1S/C16H22N2OSi/c1-16(2)9-10-18(15(16)19)14-7-6-13(12-17-14)8-11-20(3,4)5/h6-7,12H,9-10H2,1-5H3 |
| InChIKey | HPUPEUCVFLROKZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|